C30H42O4Si — CID 71608959
ethyl (2E,4E,7S)-10-[tert-butyl(diphenyl)silyl]oxy-7-methoxy-2-methyldeca-2,4-dienoate (PubChem CID 71608959) has the molecular formula C30H42O4Si and a molecular weight of 494.75 g/mol. Its IUPAC name is ethyl (2E,4E,7S)-10-[tert-butyl(diphenyl)silyl]oxy-7-methoxy-2-methyldeca-2,4-dienoate.
| Compound Name | ethyl (2E,4E,7S)-10-[tert-butyl(diphenyl)silyl]oxy-7-methoxy-2-methyldeca-2,4-dienoate |
|---|---|
| PubChem CID | 71608959 |
| Molecular Formula | C30H42O4Si |
| Molecular Weight | 494.75 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | ethyl (2E,4E,7S)-10-[tert-butyl(diphenyl)silyl]oxy-7-methoxy-2-methyldeca-2,4-dienoate |
| SMILES | CCOC(=O)/C(C)=C/C=C/C[C@H](CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC |
| InChI | InChI=1S/C30H42O4Si/c1-7-33-29(31)25(2)17-14-15-18-26(32-6)19-16-24-34-35(30(3,4)5,27-20-10-8-11-21-27)28-22-12-9-13-23-28/h8-15,17,20-23,26H,7,16,18-19,24H2,1-6H3/b15-14+,25-17+/t26-/m1/s1 |
| InChIKey | CQDCLVQJRDIPLG-ZYEOQJMFSA-N |
| XLogP | 5.81 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.75 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|