C29H36O4SeSi — CID 11800903
[5-[tert-butyl(diphenyl)silyl]oxy-2-phenylselanylpentyl] methyl carbonate (PubChem CID 11800903) has the molecular formula C29H36O4SeSi and a molecular weight of 555.65 g/mol. Its IUPAC name is [5-[tert-butyl(diphenyl)silyl]oxy-2-phenylselanylpentyl] methyl carbonate.
| Compound Name | [5-[tert-butyl(diphenyl)silyl]oxy-2-phenylselanylpentyl] methyl carbonate |
|---|---|
| PubChem CID | 11800903 |
| Molecular Formula | C29H36O4SeSi |
| Molecular Weight | 555.65 g/mol |
| Exact Mass | 556.15 |
| IUPAC Name | [5-[tert-butyl(diphenyl)silyl]oxy-2-phenylselanylpentyl] methyl carbonate |
| SMILES | COC(=O)OCC(CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[Se]c1ccccc1 |
| InChI | InChI=1S/C29H36O4SeSi/c1-29(2,3)35(26-18-10-6-11-19-26,27-20-12-7-13-21-27)33-22-14-17-25(23-32-28(30)31-4)34-24-15-8-5-9-16-24/h5-13,15-16,18-21,25H,14,17,22-23H2,1-4H3 |
| InChIKey | NZCFJGFOWMIQNL-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.65 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|