C27H37N2O5Si+ — CID 10907183
(Z)-3-[(2S)-5-[tert-butyl(diphenyl)silyl]oxy-2-ethylpentoxy]-1-hydroxy-1-methoxy-3-oxoprop-1-ene-2-diazonium (PubChem CID 10907183) has the molecular formula C27H37N2O5Si+ and a molecular weight of 497.69 g/mol. Its IUPAC name is (Z)-3-[(2S)-5-[tert-butyl(diphenyl)silyl]oxy-2-ethylpentoxy]-1-hydroxy-1-methoxy-3-oxoprop-1-ene-2-diazonium.
| Compound Name | (Z)-3-[(2S)-5-[tert-butyl(diphenyl)silyl]oxy-2-ethylpentoxy]-1-hydroxy-1-methoxy-3-oxoprop-1-ene-2-diazonium |
|---|---|
| PubChem CID | 10907183 |
| Molecular Formula | C27H37N2O5Si+ |
| Molecular Weight | 497.69 g/mol |
| Exact Mass | 497.25 |
| IUPAC Name | (Z)-3-[(2S)-5-[tert-butyl(diphenyl)silyl]oxy-2-ethylpentoxy]-1-hydroxy-1-methoxy-3-oxoprop-1-ene-2-diazonium |
| SMILES | CC[C@@H](CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)COC(=O)/C([N+]#N)=C(\O)OC |
| InChI | InChI=1S/C27H36N2O5Si/c1-6-21(20-33-26(31)24(29-28)25(30)32-5)14-13-19-34-35(27(2,3)4,22-15-9-7-10-16-22)23-17-11-8-12-18-23/h7-12,15-18,21H,6,13-14,19-20H2,1-5H3/p+1/t21-/m0/s1 |
| InChIKey | XSORGDXTACOJQF-NRFANRHFSA-O |
| XLogP | 5.14 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.69 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|