C29H36O4Si — CID 153321677
5-[tert-butyl(diphenyl)silyl]oxy-2-(3-methoxy-4-methylphenyl)pentanoic acid (PubChem CID 153321677) has the molecular formula C29H36O4Si and a molecular weight of 476.69 g/mol. Its IUPAC name is 5-[tert-butyl(diphenyl)silyl]oxy-2-(3-methoxy-4-methylphenyl)pentanoic acid.
| Compound Name | 5-[tert-butyl(diphenyl)silyl]oxy-2-(3-methoxy-4-methylphenyl)pentanoic acid |
|---|---|
| PubChem CID | 153321677 |
| Molecular Formula | C29H36O4Si |
| Molecular Weight | 476.69 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | 5-[tert-butyl(diphenyl)silyl]oxy-2-(3-methoxy-4-methylphenyl)pentanoic acid |
| SMILES | COc1cc(C(CCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C(=O)O)ccc1C |
| InChI | InChI=1S/C29H36O4Si/c1-22-18-19-23(21-27(22)32-5)26(28(30)31)17-12-20-33-34(29(2,3)4,24-13-8-6-9-14-24)25-15-10-7-11-16-25/h6-11,13-16,18-19,21,26H,12,17,20H2,1-5H3,(H,30,31) |
| InChIKey | DELJBMTWMGMELW-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.69 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|