C21H36O5Si — CID 19042101
7-[tert-butyl(dimethyl)silyl]oxy-2-(3,4-dimethoxyphenyl)heptanoic acid (PubChem CID 19042101) has the molecular formula C21H36O5Si and a molecular weight of 396.60 g/mol. Its IUPAC name is 7-[tert-butyl(dimethyl)silyl]oxy-2-(3,4-dimethoxyphenyl)heptanoic acid.
| Compound Name | 7-[tert-butyl(dimethyl)silyl]oxy-2-(3,4-dimethoxyphenyl)heptanoic acid |
|---|---|
| PubChem CID | 19042101 |
| Molecular Formula | C21H36O5Si |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 7-[tert-butyl(dimethyl)silyl]oxy-2-(3,4-dimethoxyphenyl)heptanoic acid |
| SMILES | COc1ccc(C(CCCCCO[Si](C)(C)C(C)(C)C)C(=O)O)cc1OC |
| InChI | InChI=1S/C21H36O5Si/c1-21(2,3)27(6,7)26-14-10-8-9-11-17(20(22)23)16-12-13-18(24-4)19(15-16)25-5/h12-13,15,17H,8-11,14H2,1-7H3,(H,22,23) |
| InChIKey | SBLFOMDXCPWADT-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|