C17H27ClO4Si — CID 69403957
4-[tert-butyl(dimethyl)silyl]oxy-2-(3-chloro-4-methoxyphenyl)butanoic acid (PubChem CID 69403957) has the molecular formula C17H27ClO4Si and a molecular weight of 358.94 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-2-(3-chloro-4-methoxyphenyl)butanoic acid.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-2-(3-chloro-4-methoxyphenyl)butanoic acid |
|---|---|
| PubChem CID | 69403957 |
| Molecular Formula | C17H27ClO4Si |
| Molecular Weight | 358.94 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-2-(3-chloro-4-methoxyphenyl)butanoic acid |
| SMILES | COc1ccc(C(CCO[Si](C)(C)C(C)(C)C)C(=O)O)cc1Cl |
| InChI | InChI=1S/C17H27ClO4Si/c1-17(2,3)23(5,6)22-10-9-13(16(19)20)12-7-8-15(21-4)14(18)11-12/h7-8,11,13H,9-10H2,1-6H3,(H,19,20) |
| InChIKey | WUQCLPVSZFOMCE-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.94 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|