C27H39Cl2NO5Si — CID 57198724
N-[4-[tert-butyl(dimethyl)silyl]oxy-2-(3,4-dichlorophenyl)butyl]-3,4,5-trimethoxy-2-methylbenzamide (PubChem CID 57198724) has the molecular formula C27H39Cl2NO5Si and a molecular weight of 556.60 g/mol. Its IUPAC name is N-[4-[tert-butyl(dimethyl)silyl]oxy-2-(3,4-dichlorophenyl)butyl]-3,4,5-trimethoxy-2-methylbenzamide.
| Compound Name | N-[4-[tert-butyl(dimethyl)silyl]oxy-2-(3,4-dichlorophenyl)butyl]-3,4,5-trimethoxy-2-methylbenzamide |
|---|---|
| PubChem CID | 57198724 |
| Molecular Formula | C27H39Cl2NO5Si |
| Molecular Weight | 556.60 g/mol |
| Exact Mass | 555.20 |
| IUPAC Name | N-[4-[tert-butyl(dimethyl)silyl]oxy-2-(3,4-dichlorophenyl)butyl]-3,4,5-trimethoxy-2-methylbenzamide |
| SMILES | COc1cc(C(=O)NCC(CCO[Si](C)(C)C(C)(C)C)c2ccc(Cl)c(Cl)c2)c(C)c(OC)c1OC |
| InChI | InChI=1S/C27H39Cl2NO5Si/c1-17-20(15-23(32-5)25(34-7)24(17)33-6)26(31)30-16-19(18-10-11-21(28)22(29)14-18)12-13-35-36(8,9)27(2,3)4/h10-11,14-15,19H,12-13,16H2,1-9H3,(H,30,31) |
| InChIKey | PXQURRZLQSAFSB-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.60 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|