C17H25Cl2NO3 — CID 57151426
tert-butyl N-[2-(3,4-dichlorophenyl)-5-hydroxyhexyl]carbamate (PubChem CID 57151426) has the molecular formula C17H25Cl2NO3 and a molecular weight of 362.30 g/mol. Its IUPAC name is tert-butyl N-[2-(3,4-dichlorophenyl)-5-hydroxyhexyl]carbamate.
| Compound Name | tert-butyl N-[2-(3,4-dichlorophenyl)-5-hydroxyhexyl]carbamate |
|---|---|
| PubChem CID | 57151426 |
| Molecular Formula | C17H25Cl2NO3 |
| Molecular Weight | 362.30 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | tert-butyl N-[2-(3,4-dichlorophenyl)-5-hydroxyhexyl]carbamate |
| SMILES | CC(O)CCC(CNC(=O)OC(C)(C)C)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H25Cl2NO3/c1-11(21)5-6-13(10-20-16(22)23-17(2,3)4)12-7-8-14(18)15(19)9-12/h7-9,11,13,21H,5-6,10H2,1-4H3,(H,20,22) |
| InChIKey | HOMVRFIXWFEQQJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.30 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |