C28H39Cl2NO6Si — CID 70111538
[5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2-(3,4-dichlorophenyl)-1,3-oxazolidin-3-yl]-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 70111538) has the molecular formula C28H39Cl2NO6Si and a molecular weight of 584.61 g/mol. Its IUPAC name is [5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2-(3,4-dichlorophenyl)-1,3-oxazolidin-3-yl]-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | [5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2-(3,4-dichlorophenyl)-1,3-oxazolidin-3-yl]-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 70111538 |
| Molecular Formula | C28H39Cl2NO6Si |
| Molecular Weight | 584.61 g/mol |
| Exact Mass | 583.19 |
| IUPAC Name | [5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2-(3,4-dichlorophenyl)-1,3-oxazolidin-3-yl]-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)N2CC(CCCO[Si](C)(C)C(C)(C)C)OC2c2ccc(Cl)c(Cl)c2)cc(OC)c1OC |
| InChI | InChI=1S/C28H39Cl2NO6Si/c1-28(2,3)38(7,8)36-13-9-10-20-17-31(27(37-20)18-11-12-21(29)22(30)14-18)26(32)19-15-23(33-4)25(35-6)24(16-19)34-5/h11-12,14-16,20,27H,9-10,13,17H2,1-8H3 |
| InChIKey | IINSDZDQVVRZEU-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.61 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|