C16H25ClO3Si — CID 139036162
methyl 5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-chlorobenzoate (PubChem CID 139036162) has the molecular formula C16H25ClO3Si and a molecular weight of 328.91 g/mol. Its IUPAC name is methyl 5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-chlorobenzoate.
| Compound Name | methyl 5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-chlorobenzoate |
|---|---|
| PubChem CID | 139036162 |
| Molecular Formula | C16H25ClO3Si |
| Molecular Weight | 328.91 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | methyl 5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-chlorobenzoate |
| SMILES | COC(=O)c1cc(CCO[Si](C)(C)C(C)(C)C)ccc1Cl |
| InChI | InChI=1S/C16H25ClO3Si/c1-16(2,3)21(5,6)20-10-9-12-7-8-14(17)13(11-12)15(18)19-4/h7-8,11H,9-10H2,1-6H3 |
| InChIKey | DCRDWSIUNFHTHC-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.91 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|