C16H25ClO3SSi — CID 164905280
2-[5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-chlorophenyl]sulfanylacetic acid (PubChem CID 164905280) has the molecular formula C16H25ClO3SSi and a molecular weight of 360.98 g/mol. Its IUPAC name is 2-[5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-chlorophenyl]sulfanylacetic acid.
| Compound Name | 2-[5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-chlorophenyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 164905280 |
| Molecular Formula | C16H25ClO3SSi |
| Molecular Weight | 360.98 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 2-[5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-chlorophenyl]sulfanylacetic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCCc1ccc(Cl)c(SCC(=O)O)c1 |
| InChI | InChI=1S/C16H25ClO3SSi/c1-16(2,3)22(4,5)20-9-8-12-6-7-13(17)14(10-12)21-11-15(18)19/h6-7,10H,8-9,11H2,1-5H3,(H,18,19) |
| InChIKey | GUOXOIJGGVKNSR-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.98 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|