C25H39NO5SSi — CID 57220170
N-[4-[tert-butyl(dimethyl)silyl]oxy-2-thiophen-2-ylbutyl]-3,4,5-trimethoxy-2-methylbenzamide (PubChem CID 57220170) has the molecular formula C25H39NO5SSi and a molecular weight of 493.74 g/mol. Its IUPAC name is N-[4-[tert-butyl(dimethyl)silyl]oxy-2-thiophen-2-ylbutyl]-3,4,5-trimethoxy-2-methylbenzamide.
| Compound Name | N-[4-[tert-butyl(dimethyl)silyl]oxy-2-thiophen-2-ylbutyl]-3,4,5-trimethoxy-2-methylbenzamide |
|---|---|
| PubChem CID | 57220170 |
| Molecular Formula | C25H39NO5SSi |
| Molecular Weight | 493.74 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | N-[4-[tert-butyl(dimethyl)silyl]oxy-2-thiophen-2-ylbutyl]-3,4,5-trimethoxy-2-methylbenzamide |
| SMILES | COc1cc(C(=O)NCC(CCO[Si](C)(C)C(C)(C)C)c2cccs2)c(C)c(OC)c1OC |
| InChI | InChI=1S/C25H39NO5SSi/c1-17-19(15-20(28-5)23(30-7)22(17)29-6)24(27)26-16-18(21-11-10-14-32-21)12-13-31-33(8,9)25(2,3)4/h10-11,14-15,18H,12-13,16H2,1-9H3,(H,26,27) |
| InChIKey | MOOKAEWOXXXZPO-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.74 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|