C11H10ClF3O3 — CID 65021359
3-(3-chloro-4-methoxyphenyl)-4,4,4-trifluorobutanoic acid (PubChem CID 65021359) has the molecular formula C11H10ClF3O3 and a molecular weight of 282.65 g/mol. Its IUPAC name is 3-(3-chloro-4-methoxyphenyl)-4,4,4-trifluorobutanoic acid.
| Compound Name | 3-(3-chloro-4-methoxyphenyl)-4,4,4-trifluorobutanoic acid |
|---|---|
| PubChem CID | 65021359 |
| Molecular Formula | C11H10ClF3O3 |
| Molecular Weight | 282.65 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 3-(3-chloro-4-methoxyphenyl)-4,4,4-trifluorobutanoic acid |
| SMILES | COc1ccc(C(CC(=O)O)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C11H10ClF3O3/c1-18-9-3-2-6(4-8(9)12)7(5-10(16)17)11(13,14)15/h2-4,7H,5H2,1H3,(H,16,17) |
| InChIKey | IKUOPBGJCPDGED-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.65 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |