C22H42O4Si2 — CID 10550387
4-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-methoxyphenol (PubChem CID 10550387) has the molecular formula C22H42O4Si2 and a molecular weight of 426.75 g/mol. Its IUPAC name is 4-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-methoxyphenol.
| Compound Name | 4-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 10550387 |
| Molecular Formula | C22H42O4Si2 |
| Molecular Weight | 426.75 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | 4-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-methoxyphenol |
| SMILES | COc1cc(C(CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)ccc1O |
| InChI | InChI=1S/C22H42O4Si2/c1-21(2,3)27(8,9)25-15-14-19(26-28(10,11)22(4,5)6)17-12-13-18(23)20(16-17)24-7/h12-13,16,19,23H,14-15H2,1-11H3 |
| InChIKey | PJTZGFRTOXLEOG-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.75 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|