About 4-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-methoxyphenol
4-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-methoxyphenol (PubChem CID 10550387) has the molecular formula C22H42O4Si2
and a molecular weight of 426.75 g/mol. Its IUPAC name is 4-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-methoxyphenol.
Molecular Properties
| Compound Name | 4-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-methoxyphenol |
| PubChem CID | 10550387 |
| Molecular Formula | C22H42O4Si2 |
| Molecular Weight | 426.75 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | 4-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-methoxyphenol |
| SMILES | COc1cc(C(CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)ccc1O |
| InChI | InChI=1S/C22H42O4Si2/c1-21(2,3)27(8,9)25-15-14-19(26-28(10,11)22(4,5)6)17-12-13-18(23)20(16-17)24-7/h12-13,16,19,23H,14-15H2,1-11H3 |
| InChIKey | PJTZGFRTOXLEOG-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.75 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-methoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-methoxyphenol?
The IUPAC name of 4-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-methoxyphenol (CID 10550387) is 4-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-methoxyphenol.
What is the SMILES notation for 4-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-methoxyphenol?
The canonical SMILES for 4-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-methoxyphenol is COc1cc(C(CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)ccc1O.
What is the InChIKey of 4-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-methoxyphenol?
The InChIKey is PJTZGFRTOXLEOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H42O4Si2/c1-21(2,3)27(8,9)25-15-14-19(26-28(10,11)22(4,5)6)17-12-13-18(23)20(16-17)24-7/h12-13,16,19,23H,14-15H2,1-11H3.
What are the key properties of 4-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-methoxyphenol?
4-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-methoxyphenol has a molecular weight of 426.75 g/mol, XLogP of 6.88, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-2-methoxyphenol is sourced from PubChem (CID 10550387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).