C22H31FO4Si — CID 177401675
tert-butyl-[1-(3,4-dimethoxyphenyl)-2-(4-fluorophenoxy)ethoxy]-dimethylsilane (PubChem CID 177401675) has the molecular formula C22H31FO4Si and a molecular weight of 406.57 g/mol. Its IUPAC name is tert-butyl-[1-(3,4-dimethoxyphenyl)-2-(4-fluorophenoxy)ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[1-(3,4-dimethoxyphenyl)-2-(4-fluorophenoxy)ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 177401675 |
| Molecular Formula | C22H31FO4Si |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | tert-butyl-[1-(3,4-dimethoxyphenyl)-2-(4-fluorophenoxy)ethoxy]-dimethylsilane |
| SMILES | COc1ccc(C(COc2ccc(F)cc2)O[Si](C)(C)C(C)(C)C)cc1OC |
| InChI | InChI=1S/C22H31FO4Si/c1-22(2,3)28(6,7)27-21(15-26-18-11-9-17(23)10-12-18)16-8-13-19(24-4)20(14-16)25-5/h8-14,21H,15H2,1-7H3 |
| InChIKey | YXVQHCUHKNWTIO-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|