C23H38O5Si — CID 15605696
methyl (2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-4-(3-methoxy-4-prop-2-enoxyphenyl)-2,3-dimethylbutanoate (PubChem CID 15605696) has the molecular formula C23H38O5Si and a molecular weight of 422.64 g/mol. Its IUPAC name is methyl (2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-4-(3-methoxy-4-prop-2-enoxyphenyl)-2,3-dimethylbutanoate.
| Compound Name | methyl (2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-4-(3-methoxy-4-prop-2-enoxyphenyl)-2,3-dimethylbutanoate |
|---|---|
| PubChem CID | 15605696 |
| Molecular Formula | C23H38O5Si |
| Molecular Weight | 422.64 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | methyl (2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-4-(3-methoxy-4-prop-2-enoxyphenyl)-2,3-dimethylbutanoate |
| SMILES | C=CCOc1ccc([C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H](C)C(=O)OC)cc1OC |
| InChI | InChI=1S/C23H38O5Si/c1-11-14-27-19-13-12-18(15-20(19)25-7)21(16(2)17(3)22(24)26-8)28-29(9,10)23(4,5)6/h11-13,15-17,21H,1,14H2,2-10H3/t16-,17-,21-/m1/s1 |
| InChIKey | UKOKRKFYJMUKIO-CBGDNZLLSA-N |
| XLogP | 5.77 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.64 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|