C23H37NO2 — CID 10109134
(4R)-2-tert-butyl-4-[(1Z,5E,7E,11R)-11-methoxy-8-methyltetradeca-1,5,7,13-tetraenyl]-4,5-dihydro-1,3-oxazole (PubChem CID 10109134) has the molecular formula C23H37NO2 and a molecular weight of 359.55 g/mol. Its IUPAC name is (4R)-2-tert-butyl-4-[(1Z,5E,7E,11R)-11-methoxy-8-methyltetradeca-1,5,7,13-tetraenyl]-4,5-dihydro-1,3-oxazole.
| Compound Name | (4R)-2-tert-butyl-4-[(1Z,5E,7E,11R)-11-methoxy-8-methyltetradeca-1,5,7,13-tetraenyl]-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 10109134 |
| Molecular Formula | C23H37NO2 |
| Molecular Weight | 359.55 g/mol |
| Exact Mass | 359.28 |
| IUPAC Name | (4R)-2-tert-butyl-4-[(1Z,5E,7E,11R)-11-methoxy-8-methyltetradeca-1,5,7,13-tetraenyl]-4,5-dihydro-1,3-oxazole |
| SMILES | C=CC[C@@H](CC/C(C)=C/C=C/CC/C=C\[C@@H]1COC(C(C)(C)C)=N1)OC |
| InChI | InChI=1S/C23H37NO2/c1-7-13-21(25-6)17-16-19(2)14-11-9-8-10-12-15-20-18-26-22(24-20)23(3,4)5/h7,9,11-12,14-15,20-21H,1,8,10,13,16-18H2,2-6H3/b11-9+,15-12-,19-14+/t20-,21+/m1/s1 |
| InChIKey | TUAZPCDHSQTVIV-WURYWLRBSA-N |
| XLogP | 6.04 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.55 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|