C29H37NO2S — CID 73354445
[(4R,7E,9E,13Z)-7-methyl-14-[(4R)-2-[(1R,2S)-2-methylcyclopropyl]-4,5-dihydro-1,3-thiazol-4-yl]tetradeca-1,7,9,13-tetraen-4-yl] benzoate (PubChem CID 73354445) has the molecular formula C29H37NO2S and a molecular weight of 463.69 g/mol. Its IUPAC name is [(4R,7E,9E,13Z)-7-methyl-14-[(4R)-2-[(1R,2S)-2-methylcyclopropyl]-4,5-dihydro-1,3-thiazol-4-yl]tetradeca-1,7,9,13-tetraen-4-yl] benzoate.
| Compound Name | [(4R,7E,9E,13Z)-7-methyl-14-[(4R)-2-[(1R,2S)-2-methylcyclopropyl]-4,5-dihydro-1,3-thiazol-4-yl]tetradeca-1,7,9,13-tetraen-4-yl] benzoate |
|---|---|
| PubChem CID | 73354445 |
| Molecular Formula | C29H37NO2S |
| Molecular Weight | 463.69 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | [(4R,7E,9E,13Z)-7-methyl-14-[(4R)-2-[(1R,2S)-2-methylcyclopropyl]-4,5-dihydro-1,3-thiazol-4-yl]tetradeca-1,7,9,13-tetraen-4-yl] benzoate |
| SMILES | C=CC[C@@H](CC/C(C)=C/C=C/CC/C=C\[C@@H]1CSC([C@@H]2C[C@@H]2C)=N1)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H37NO2S/c1-4-13-26(32-29(31)24-15-10-8-11-16-24)19-18-22(2)14-9-6-5-7-12-17-25-21-33-28(30-25)27-20-23(27)3/h4,6,8-12,14-17,23,25-27H,1,5,7,13,18-21H2,2-3H3/b9-6+,17-12-,22-14+/t23-,25+,26-,27+/m0/s1 |
| InChIKey | WHWBXBQXGSMKPN-CHGSQCMHSA-N |
| XLogP | 7.58 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.69 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|