C15H26O2 — CID 10922612
(4E,6E,10R)-10-methoxy-7-methyltrideca-4,6,12-trien-1-ol (PubChem CID 10922612) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is (4E,6E,10R)-10-methoxy-7-methyltrideca-4,6,12-trien-1-ol.
| Compound Name | (4E,6E,10R)-10-methoxy-7-methyltrideca-4,6,12-trien-1-ol |
|---|---|
| PubChem CID | 10922612 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | (4E,6E,10R)-10-methoxy-7-methyltrideca-4,6,12-trien-1-ol |
| SMILES | C=CC[C@@H](CC/C(C)=C/C=C/CCCO)OC |
| InChI | InChI=1S/C15H26O2/c1-4-9-15(17-3)12-11-14(2)10-7-5-6-8-13-16/h4-5,7,10,15-16H,1,6,8-9,11-13H2,2-3H3/b7-5+,14-10+/t15-/m0/s1 |
| InChIKey | HUWREOAELWRMFF-KCQUFVDESA-N |
| XLogP | 3.63 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|