C11H19BrO — CID 139718586
(4R,7E)-9-bromo-4-methoxy-7-methylnona-1,7-diene (PubChem CID 139718586) has the molecular formula C11H19BrO and a molecular weight of 247.18 g/mol. Its IUPAC name is (4R,7E)-9-bromo-4-methoxy-7-methylnona-1,7-diene.
| Compound Name | (4R,7E)-9-bromo-4-methoxy-7-methylnona-1,7-diene |
|---|---|
| PubChem CID | 139718586 |
| Molecular Formula | C11H19BrO |
| Molecular Weight | 247.18 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | (4R,7E)-9-bromo-4-methoxy-7-methylnona-1,7-diene |
| SMILES | C=CC[C@@H](CC/C(C)=C/CBr)OC |
| InChI | InChI=1S/C11H19BrO/c1-4-5-11(13-3)7-6-10(2)8-9-12/h4,8,11H,1,5-7,9H2,2-3H3/b10-8+/t11-/m0/s1 |
| InChIKey | BASDPULVBQKEIJ-UQSGXBNBSA-N |
| XLogP | 3.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.18 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|