C11H21BrO — CID 21485156
(E)-1-bromo-6-methoxy-3,7-dimethyloct-2-ene (PubChem CID 21485156) has the molecular formula C11H21BrO and a molecular weight of 249.19 g/mol. Its IUPAC name is (E)-1-bromo-6-methoxy-3,7-dimethyloct-2-ene.
| Compound Name | (E)-1-bromo-6-methoxy-3,7-dimethyloct-2-ene |
|---|---|
| PubChem CID | 21485156 |
| Molecular Formula | C11H21BrO |
| Molecular Weight | 249.19 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | (E)-1-bromo-6-methoxy-3,7-dimethyloct-2-ene |
| SMILES | COC(CC/C(C)=C/CBr)C(C)C |
| InChI | InChI=1S/C11H21BrO/c1-9(2)11(13-4)6-5-10(3)7-8-12/h7,9,11H,5-6,8H2,1-4H3/b10-7+ |
| InChIKey | NWMWFNZXZZADIW-JXMROGBWSA-N |
| XLogP | 3.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.19 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|