C8H10BrCl3 — CID 54152054
7-bromo-1,1,2-trichloro-5-methylhepta-1,5-diene (PubChem CID 54152054) has the molecular formula C8H10BrCl3 and a molecular weight of 292.43 g/mol. Its IUPAC name is 7-bromo-1,1,2-trichloro-5-methylhepta-1,5-diene.
| Compound Name | 7-bromo-1,1,2-trichloro-5-methylhepta-1,5-diene |
|---|---|
| PubChem CID | 54152054 |
| Molecular Formula | C8H10BrCl3 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 289.90 |
| IUPAC Name | 7-bromo-1,1,2-trichloro-5-methylhepta-1,5-diene |
| SMILES | CC(=CCBr)CCC(Cl)=C(Cl)Cl |
| InChI | InChI=1S/C8H10BrCl3/c1-6(4-5-9)2-3-7(10)8(11)12/h4H,2-3,5H2,1H3 |
| InChIKey | OIKWHZJCINBBRE-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|