C13H21BrO — CID 21485221
(E)-1-bromo-3,7-dimethyl-7-prop-1-ynoxyoct-2-ene (PubChem CID 21485221) has the molecular formula C13H21BrO and a molecular weight of 273.21 g/mol. Its IUPAC name is (E)-1-bromo-3,7-dimethyl-7-prop-1-ynoxyoct-2-ene.
| Compound Name | (E)-1-bromo-3,7-dimethyl-7-prop-1-ynoxyoct-2-ene |
|---|---|
| PubChem CID | 21485221 |
| Molecular Formula | C13H21BrO |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | (E)-1-bromo-3,7-dimethyl-7-prop-1-ynoxyoct-2-ene |
| SMILES | CC#COC(C)(C)CCC/C(C)=C/CBr |
| InChI | InChI=1S/C13H21BrO/c1-5-11-15-13(3,4)9-6-7-12(2)8-10-14/h8H,6-7,9-10H2,1-4H3/b12-8+ |
| InChIKey | NUYOLQJXEOFUKG-XYOKQWHBSA-N |
| XLogP | 4.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|