About 1-bromo-3,7-dimethyl-7-prop-1-ynoxyoct-2-ene
1-bromo-3,7-dimethyl-7-prop-1-ynoxyoct-2-ene (PubChem CID 54131908) has the molecular formula C13H21BrO
and a molecular weight of 273.21 g/mol. Its IUPAC name is 1-bromo-3,7-dimethyl-7-prop-1-ynoxyoct-2-ene.
Molecular Properties
| Compound Name | 1-bromo-3,7-dimethyl-7-prop-1-ynoxyoct-2-ene |
| PubChem CID | 54131908 |
| Molecular Formula | C13H21BrO |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 1-bromo-3,7-dimethyl-7-prop-1-ynoxyoct-2-ene |
| SMILES | CC#COC(C)(C)CCCC(C)=CCBr |
| InChI | InChI=1S/C13H21BrO/c1-5-11-15-13(3,4)9-6-7-12(2)8-10-14/h8H,6-7,9-10H2,1-4H3 |
| InChIKey | NUYOLQJXEOFUKG-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-3,7-dimethyl-7-prop-1-ynoxyoct-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3,7-dimethyl-7-prop-1-ynoxyoct-2-ene?
The IUPAC name of 1-bromo-3,7-dimethyl-7-prop-1-ynoxyoct-2-ene (CID 54131908) is 1-bromo-3,7-dimethyl-7-prop-1-ynoxyoct-2-ene.
What is the SMILES notation for 1-bromo-3,7-dimethyl-7-prop-1-ynoxyoct-2-ene?
The canonical SMILES for 1-bromo-3,7-dimethyl-7-prop-1-ynoxyoct-2-ene is CC#COC(C)(C)CCCC(C)=CCBr.
What is the InChIKey of 1-bromo-3,7-dimethyl-7-prop-1-ynoxyoct-2-ene?
The InChIKey is NUYOLQJXEOFUKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21BrO/c1-5-11-15-13(3,4)9-6-7-12(2)8-10-14/h8H,6-7,9-10H2,1-4H3.
What are the key properties of 1-bromo-3,7-dimethyl-7-prop-1-ynoxyoct-2-ene?
1-bromo-3,7-dimethyl-7-prop-1-ynoxyoct-2-ene has a molecular weight of 273.21 g/mol, XLogP of 4.27, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3,7-dimethyl-7-prop-1-ynoxyoct-2-ene is sourced from PubChem (CID 54131908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).