C21H34O2 — CID 5383800
1-[(E)-3,7-dimethyl-7-propoxyoct-2-enoxy]-4-ethylbenzene (PubChem CID 5383800) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is 1-[(E)-3,7-dimethyl-7-propoxyoct-2-enoxy]-4-ethylbenzene.
| Compound Name | 1-[(E)-3,7-dimethyl-7-propoxyoct-2-enoxy]-4-ethylbenzene |
|---|---|
| PubChem CID | 5383800 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | 1-[(E)-3,7-dimethyl-7-propoxyoct-2-enoxy]-4-ethylbenzene |
| SMILES | CCCOC(C)(C)CCC/C(C)=C/COc1ccc(CC)cc1 |
| InChI | InChI=1S/C21H34O2/c1-6-16-23-21(4,5)15-8-9-18(3)14-17-22-20-12-10-19(7-2)11-13-20/h10-14H,6-9,15-17H2,1-5H3/b18-14+ |
| InChIKey | MUHUACHCGJPJDB-NBVRZTHBSA-N |
| XLogP | 5.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|