C19H32O2 — CID 22749891
1-ethyl-4-(7-methoxy-3,7-dimethyloctoxy)benzene (PubChem CID 22749891) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is 1-ethyl-4-(7-methoxy-3,7-dimethyloctoxy)benzene.
| Compound Name | 1-ethyl-4-(7-methoxy-3,7-dimethyloctoxy)benzene |
|---|---|
| PubChem CID | 22749891 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 1-ethyl-4-(7-methoxy-3,7-dimethyloctoxy)benzene |
| SMILES | CCc1ccc(OCCC(C)CCCC(C)(C)OC)cc1 |
| InChI | InChI=1S/C19H32O2/c1-6-17-9-11-18(12-10-17)21-15-13-16(2)8-7-14-19(3,4)20-5/h9-12,16H,6-8,13-15H2,1-5H3 |
| InChIKey | UCLDQKQEBWKQSD-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |