C17H25F3O2 — CID 154186424
2,6-dimethyl-8-[4-(trifluoromethyl)phenoxy]octan-2-ol (PubChem CID 154186424) has the molecular formula C17H25F3O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is 2,6-dimethyl-8-[4-(trifluoromethyl)phenoxy]octan-2-ol.
| Compound Name | 2,6-dimethyl-8-[4-(trifluoromethyl)phenoxy]octan-2-ol |
|---|---|
| PubChem CID | 154186424 |
| Molecular Formula | C17H25F3O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 2,6-dimethyl-8-[4-(trifluoromethyl)phenoxy]octan-2-ol |
| SMILES | CC(CCCC(C)(C)O)CCOc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H25F3O2/c1-13(5-4-11-16(2,3)21)10-12-22-15-8-6-14(7-9-15)17(18,19)20/h6-9,13,21H,4-5,10-12H2,1-3H3 |
| InChIKey | ZGUYMZDPOOTLEG-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |