C20H30O3 — CID 54221554
6-(6-ethoxy-3,6-dimethylhept-2-enoxy)-2-methyl-2,3-dihydro-1-benzofuran (PubChem CID 54221554) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is 6-(6-ethoxy-3,6-dimethylhept-2-enoxy)-2-methyl-2,3-dihydro-1-benzofuran.
| Compound Name | 6-(6-ethoxy-3,6-dimethylhept-2-enoxy)-2-methyl-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 54221554 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 6-(6-ethoxy-3,6-dimethylhept-2-enoxy)-2-methyl-2,3-dihydro-1-benzofuran |
| SMILES | CCOC(C)(C)CCC(C)=CCOc1ccc2c(c1)OC(C)C2 |
| InChI | InChI=1S/C20H30O3/c1-6-22-20(4,5)11-9-15(2)10-12-21-18-8-7-17-13-16(3)23-19(17)14-18/h7-8,10,14,16H,6,9,11-13H2,1-5H3 |
| InChIKey | QCXXOQAMHYNOIB-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|