C22H36O2 — CID 54240615
1-(7-butoxy-3,7-dimethyloct-2-enoxy)-4-ethylbenzene (PubChem CID 54240615) has the molecular formula C22H36O2 and a molecular weight of 332.53 g/mol. Its IUPAC name is 1-(7-butoxy-3,7-dimethyloct-2-enoxy)-4-ethylbenzene.
| Compound Name | 1-(7-butoxy-3,7-dimethyloct-2-enoxy)-4-ethylbenzene |
|---|---|
| PubChem CID | 54240615 |
| Molecular Formula | C22H36O2 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | 1-(7-butoxy-3,7-dimethyloct-2-enoxy)-4-ethylbenzene |
| SMILES | CCCCOC(C)(C)CCCC(C)=CCOc1ccc(CC)cc1 |
| InChI | InChI=1S/C22H36O2/c1-6-8-17-24-22(4,5)16-9-10-19(3)15-18-23-21-13-11-20(7-2)12-14-21/h11-15H,6-10,16-18H2,1-5H3 |
| InChIKey | QPSYQSUTJQFFFE-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|