C21H34O2 — CID 54102776
3,7-diethyl-9-(4-ethylphenoxy)non-7-en-3-ol (PubChem CID 54102776) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is 3,7-diethyl-9-(4-ethylphenoxy)non-7-en-3-ol.
| Compound Name | 3,7-diethyl-9-(4-ethylphenoxy)non-7-en-3-ol |
|---|---|
| PubChem CID | 54102776 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | 3,7-diethyl-9-(4-ethylphenoxy)non-7-en-3-ol |
| SMILES | CCC(=CCOc1ccc(CC)cc1)CCCC(O)(CC)CC |
| InChI | InChI=1S/C21H34O2/c1-5-18(10-9-16-21(22,7-3)8-4)15-17-23-20-13-11-19(6-2)12-14-20/h11-15,22H,5-10,16-17H2,1-4H3 |
| InChIKey | NBRDINMFQVZOBV-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|