About 1-chloro-4-[(2E)-7,7-dichloro-3-ethylhepta-2,6-dienoxy]benzene
1-chloro-4-[(2E)-7,7-dichloro-3-ethylhepta-2,6-dienoxy]benzene (PubChem CID 21489607) has the molecular formula C15H17Cl3O
and a molecular weight of 319.66 g/mol. Its IUPAC name is 1-chloro-4-[(2E)-7,7-dichloro-3-ethylhepta-2,6-dienoxy]benzene.
Molecular Properties
| Compound Name | 1-chloro-4-[(2E)-7,7-dichloro-3-ethylhepta-2,6-dienoxy]benzene |
| PubChem CID | 21489607 |
| Molecular Formula | C15H17Cl3O |
| Molecular Weight | 319.66 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 1-chloro-4-[(2E)-7,7-dichloro-3-ethylhepta-2,6-dienoxy]benzene |
| SMILES | CC/C(=C\COc1ccc(Cl)cc1)CCC=C(Cl)Cl |
| InChI | InChI=1S/C15H17Cl3O/c1-2-12(4-3-5-15(17)18)10-11-19-14-8-6-13(16)7-9-14/h5-10H,2-4,11H2,1H3/b12-10+ |
| InChIKey | FVYCLQLRCSBALF-ZRDIBKRKSA-N |
| XLogP | 6.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 319.66 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-4-[(2E)-7,7-dichloro-3-ethylhepta-2,6-dienoxy]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-[(2E)-7,7-dichloro-3-ethylhepta-2,6-dienoxy]benzene?
The IUPAC name of 1-chloro-4-[(2E)-7,7-dichloro-3-ethylhepta-2,6-dienoxy]benzene (CID 21489607) is 1-chloro-4-[(2E)-7,7-dichloro-3-ethylhepta-2,6-dienoxy]benzene.
What is the SMILES notation for 1-chloro-4-[(2E)-7,7-dichloro-3-ethylhepta-2,6-dienoxy]benzene?
The canonical SMILES for 1-chloro-4-[(2E)-7,7-dichloro-3-ethylhepta-2,6-dienoxy]benzene is CC/C(=C\COc1ccc(Cl)cc1)CCC=C(Cl)Cl.
What is the InChIKey of 1-chloro-4-[(2E)-7,7-dichloro-3-ethylhepta-2,6-dienoxy]benzene?
The InChIKey is FVYCLQLRCSBALF-ZRDIBKRKSA-N. The full InChI is InChI=1S/C15H17Cl3O/c1-2-12(4-3-5-15(17)18)10-11-19-14-8-6-13(16)7-9-14/h5-10H,2-4,11H2,1H3/b12-10+.
What are the key properties of 1-chloro-4-[(2E)-7,7-dichloro-3-ethylhepta-2,6-dienoxy]benzene?
1-chloro-4-[(2E)-7,7-dichloro-3-ethylhepta-2,6-dienoxy]benzene has a molecular weight of 319.66 g/mol, XLogP of 6.15, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-[(2E)-7,7-dichloro-3-ethylhepta-2,6-dienoxy]benzene is sourced from PubChem (CID 21489607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).