C15H17Cl3O — CID 21489607
1-chloro-4-[(2E)-7,7-dichloro-3-ethylhepta-2,6-dienoxy]benzene (PubChem CID 21489607) has the molecular formula C15H17Cl3O and a molecular weight of 319.66 g/mol. Its IUPAC name is 1-chloro-4-[(2E)-7,7-dichloro-3-ethylhepta-2,6-dienoxy]benzene.
| Compound Name | 1-chloro-4-[(2E)-7,7-dichloro-3-ethylhepta-2,6-dienoxy]benzene |
|---|---|
| PubChem CID | 21489607 |
| Molecular Formula | C15H17Cl3O |
| Molecular Weight | 319.66 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 1-chloro-4-[(2E)-7,7-dichloro-3-ethylhepta-2,6-dienoxy]benzene |
| SMILES | CC/C(=C\COc1ccc(Cl)cc1)CCC=C(Cl)Cl |
| InChI | InChI=1S/C15H17Cl3O/c1-2-12(4-3-5-15(17)18)10-11-19-14-8-6-13(16)7-9-14/h5-10H,2-4,11H2,1H3/b12-10+ |
| InChIKey | FVYCLQLRCSBALF-ZRDIBKRKSA-N |
| XLogP | 6.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.66 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|