C18H17Cl3O2 — CID 71409019
1-chloro-4-[[4-(5,5-dichloropent-4-enoxy)phenoxy]methyl]benzene (PubChem CID 71409019) has the molecular formula C18H17Cl3O2 and a molecular weight of 371.69 g/mol. Its IUPAC name is 1-chloro-4-[[4-(5,5-dichloropent-4-enoxy)phenoxy]methyl]benzene.
| Compound Name | 1-chloro-4-[[4-(5,5-dichloropent-4-enoxy)phenoxy]methyl]benzene |
|---|---|
| PubChem CID | 71409019 |
| Molecular Formula | C18H17Cl3O2 |
| Molecular Weight | 371.69 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 1-chloro-4-[[4-(5,5-dichloropent-4-enoxy)phenoxy]methyl]benzene |
| SMILES | ClC(Cl)=CCCCOc1ccc(OCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C18H17Cl3O2/c19-15-6-4-14(5-7-15)13-23-17-10-8-16(9-11-17)22-12-2-1-3-18(20)21/h3-11H,1-2,12-13H2 |
| InChIKey | PTAIKKWHEPDSET-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.69 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|