C15H18Cl2O2 — CID 21489597
1-[(2E)-7,7-dichloro-3-methylhepta-2,6-dienoxy]-3-methoxybenzene (PubChem CID 21489597) has the molecular formula C15H18Cl2O2 and a molecular weight of 301.21 g/mol. Its IUPAC name is 1-[(2E)-7,7-dichloro-3-methylhepta-2,6-dienoxy]-3-methoxybenzene.
| Compound Name | 1-[(2E)-7,7-dichloro-3-methylhepta-2,6-dienoxy]-3-methoxybenzene |
|---|---|
| PubChem CID | 21489597 |
| Molecular Formula | C15H18Cl2O2 |
| Molecular Weight | 301.21 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 1-[(2E)-7,7-dichloro-3-methylhepta-2,6-dienoxy]-3-methoxybenzene |
| SMILES | COc1cccc(OC/C=C(\C)CCC=C(Cl)Cl)c1 |
| InChI | InChI=1S/C15H18Cl2O2/c1-12(5-3-8-15(16)17)9-10-19-14-7-4-6-13(11-14)18-2/h4,6-9,11H,3,5,10H2,1-2H3/b12-9+ |
| InChIKey | AUYGWEXGGAKPCB-FMIVXFBMSA-N |
| XLogP | 5.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.21 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|