C23H34O2 — CID 5383795
3-[(3E,7E)-9-(3-ethylphenoxy)-3,7-dimethylnona-3,7-dienyl]-2,2-dimethyloxirane (PubChem CID 5383795) has the molecular formula C23H34O2 and a molecular weight of 342.52 g/mol. Its IUPAC name is 3-[(3E,7E)-9-(3-ethylphenoxy)-3,7-dimethylnona-3,7-dienyl]-2,2-dimethyloxirane.
| Compound Name | 3-[(3E,7E)-9-(3-ethylphenoxy)-3,7-dimethylnona-3,7-dienyl]-2,2-dimethyloxirane |
|---|---|
| PubChem CID | 5383795 |
| Molecular Formula | C23H34O2 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | 3-[(3E,7E)-9-(3-ethylphenoxy)-3,7-dimethylnona-3,7-dienyl]-2,2-dimethyloxirane |
| SMILES | CCc1cccc(OC/C=C(\C)CC/C=C(\C)CCC2OC2(C)C)c1 |
| InChI | InChI=1S/C23H34O2/c1-6-20-11-8-12-21(17-20)24-16-15-19(3)10-7-9-18(2)13-14-22-23(4,5)25-22/h8-9,11-12,15,17,22H,6-7,10,13-14,16H2,1-5H3/b18-9+,19-15+ |
| InChIKey | ROVZTDRLWBQVMA-RKACFXBMSA-N |
| XLogP | 6.26 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|