C29H40OS2 — CID 101117785
3-[(3E,7E,11E)-15-(1,3-benzodithiol-2-ylidene)-3,7,12-trimethylpentadeca-3,7,11-trienyl]-2,2-dimethyloxirane (PubChem CID 101117785) has the molecular formula C29H40OS2 and a molecular weight of 468.77 g/mol. Its IUPAC name is 3-[(3E,7E,11E)-15-(1,3-benzodithiol-2-ylidene)-3,7,12-trimethylpentadeca-3,7,11-trienyl]-2,2-dimethyloxirane.
| Compound Name | 3-[(3E,7E,11E)-15-(1,3-benzodithiol-2-ylidene)-3,7,12-trimethylpentadeca-3,7,11-trienyl]-2,2-dimethyloxirane |
|---|---|
| PubChem CID | 101117785 |
| Molecular Formula | C29H40OS2 |
| Molecular Weight | 468.77 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 3-[(3E,7E,11E)-15-(1,3-benzodithiol-2-ylidene)-3,7,12-trimethylpentadeca-3,7,11-trienyl]-2,2-dimethyloxirane |
| SMILES | C/C(=C\CC/C=C(\C)CC/C=C(\C)CCC1OC1(C)C)CCC=C1Sc2ccccc2S1 |
| InChI | InChI=1S/C29H40OS2/c1-22(14-10-15-24(3)20-21-27-29(4,5)30-27)12-6-7-13-23(2)16-11-19-28-31-25-17-8-9-18-26(25)32-28/h8-9,12-13,15,17-19,27H,6-7,10-11,14,16,20-21H2,1-5H3/b22-12+,23-13+,24-15+ |
| InChIKey | MPPLYFBRRHNKFV-QBCJLAPNSA-N |
| XLogP | 9.86 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.77 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|