C27H40O2 — CID 11234877
2,2-dimethyl-3-[(3E,7E,11E)-3,7,11-trimethyl-13-phenylmethoxytrideca-3,7,11-trienyl]oxirane (PubChem CID 11234877) has the molecular formula C27H40O2 and a molecular weight of 396.62 g/mol. Its IUPAC name is 2,2-dimethyl-3-[(3E,7E,11E)-3,7,11-trimethyl-13-phenylmethoxytrideca-3,7,11-trienyl]oxirane.
| Compound Name | 2,2-dimethyl-3-[(3E,7E,11E)-3,7,11-trimethyl-13-phenylmethoxytrideca-3,7,11-trienyl]oxirane |
|---|---|
| PubChem CID | 11234877 |
| Molecular Formula | C27H40O2 |
| Molecular Weight | 396.62 g/mol |
| Exact Mass | 396.30 |
| IUPAC Name | 2,2-dimethyl-3-[(3E,7E,11E)-3,7,11-trimethyl-13-phenylmethoxytrideca-3,7,11-trienyl]oxirane |
| SMILES | C/C(=C\CC/C(C)=C/COCc1ccccc1)CC/C=C(\C)CCC1OC1(C)C |
| InChI | InChI=1S/C27H40O2/c1-22(11-9-13-23(2)17-18-26-27(4,5)29-26)12-10-14-24(3)19-20-28-21-25-15-7-6-8-16-25/h6-8,12-13,15-16,19,26H,9-11,14,17-18,20-21H2,1-5H3/b22-12+,23-13+,24-19+ |
| InChIKey | DXSMADFLFLHJPO-YNGKQARASA-N |
| XLogP | 7.56 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.62 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|