C17H27N2O3+ — CID 6540641
(E)-2-[(2E,6E)-9-[(2R)-3,3-dimethyloxiran-2-yl]-3,7-dimethylnona-2,6-dienoxy]-2-hydroxyethenediazonium (PubChem CID 6540641) has the molecular formula C17H27N2O3+ and a molecular weight of 307.41 g/mol. Its IUPAC name is (E)-2-[(2E,6E)-9-[(2R)-3,3-dimethyloxiran-2-yl]-3,7-dimethylnona-2,6-dienoxy]-2-hydroxyethenediazonium.
| Compound Name | (E)-2-[(2E,6E)-9-[(2R)-3,3-dimethyloxiran-2-yl]-3,7-dimethylnona-2,6-dienoxy]-2-hydroxyethenediazonium |
|---|---|
| PubChem CID | 6540641 |
| Molecular Formula | C17H27N2O3+ |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | (E)-2-[(2E,6E)-9-[(2R)-3,3-dimethyloxiran-2-yl]-3,7-dimethylnona-2,6-dienoxy]-2-hydroxyethenediazonium |
| SMILES | C/C(=C\CO/C(O)=C/[N+]#N)CC/C=C(\C)CC[C@H]1OC1(C)C |
| InChI | InChI=1S/C17H26N2O3/c1-13(8-9-15-17(3,4)22-15)6-5-7-14(2)10-11-21-16(20)12-19-18/h6,10,12,15H,5,7-9,11H2,1-4H3/p+1/b13-6+,14-10+,16-12+/t15-/m1/s1 |
| InChIKey | BWKQDFQFEBGOQJ-TYPJRRNASA-O |
| XLogP | 4.84 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|