C20H36O8P2 — CID 168749299
[(2E,6E,10E)-13-(3,3-dimethyloxiran-2-yl)-3,7,11-trimethyltrideca-2,6,10-trienyl] phosphono hydrogen phosphate (PubChem CID 168749299) has the molecular formula C20H36O8P2 and a molecular weight of 466.45 g/mol. Its IUPAC name is [(2E,6E,10E)-13-(3,3-dimethyloxiran-2-yl)-3,7,11-trimethyltrideca-2,6,10-trienyl] phosphono hydrogen phosphate.
| Compound Name | [(2E,6E,10E)-13-(3,3-dimethyloxiran-2-yl)-3,7,11-trimethyltrideca-2,6,10-trienyl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 168749299 |
| Molecular Formula | C20H36O8P2 |
| Molecular Weight | 466.45 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | [(2E,6E,10E)-13-(3,3-dimethyloxiran-2-yl)-3,7,11-trimethyltrideca-2,6,10-trienyl] phosphono hydrogen phosphate |
| SMILES | C/C(=C\CC/C(C)=C/COP(=O)(O)OP(=O)(O)O)CC/C=C(\C)CCC1OC1(C)C |
| InChI | InChI=1S/C20H36O8P2/c1-16(8-6-10-17(2)12-13-19-20(4,5)27-19)9-7-11-18(3)14-15-26-30(24,25)28-29(21,22)23/h9-10,14,19H,6-8,11-13,15H2,1-5H3,(H,24,25)(H2,21,22,23)/b16-9+,17-10+,18-14+ |
| InChIKey | XGJKIFRZFLCEBP-OGJIFNPOSA-N |
| XLogP | 5.57 |
| TPSA | 125.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.45 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|