C15H26O7P2 — CID 100961461
[(2E,6E)-10-cyclopropylidene-3,7-dimethyldeca-2,6-dienyl] phosphono hydrogen phosphate (PubChem CID 100961461) has the molecular formula C15H26O7P2 and a molecular weight of 380.31 g/mol. Its IUPAC name is [(2E,6E)-10-cyclopropylidene-3,7-dimethyldeca-2,6-dienyl] phosphono hydrogen phosphate.
| Compound Name | [(2E,6E)-10-cyclopropylidene-3,7-dimethyldeca-2,6-dienyl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 100961461 |
| Molecular Formula | C15H26O7P2 |
| Molecular Weight | 380.31 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | [(2E,6E)-10-cyclopropylidene-3,7-dimethyldeca-2,6-dienyl] phosphono hydrogen phosphate |
| SMILES | C/C(=C\CC/C(C)=C/COP(=O)(O)OP(=O)(O)O)CCC=C1CC1 |
| InChI | InChI=1S/C15H26O7P2/c1-13(7-4-8-15-9-10-15)5-3-6-14(2)11-12-21-24(19,20)22-23(16,17)18/h5,8,11H,3-4,6-7,9-10,12H2,1-2H3,(H,19,20)(H2,16,17,18)/b13-5+,14-11+ |
| InChIKey | KGLVGIBUIVHTDU-ITAUJFPCSA-N |
| XLogP | 4.39 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.31 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|