C17H27N2O2+ — CID 10946207
(E)-2-hydroxy-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]ethenediazonium (PubChem CID 10946207) has the molecular formula C17H27N2O2+ and a molecular weight of 291.42 g/mol. Its IUPAC name is (E)-2-hydroxy-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]ethenediazonium.
| Compound Name | (E)-2-hydroxy-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]ethenediazonium |
|---|---|
| PubChem CID | 10946207 |
| Molecular Formula | C17H27N2O2+ |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | (E)-2-hydroxy-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]ethenediazonium |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CO/C(O)=C/[N+]#N |
| InChI | InChI=1S/C17H26N2O2/c1-14(2)7-5-8-15(3)9-6-10-16(4)11-12-21-17(20)13-19-18/h7,9,11,13H,5-6,8,10,12H2,1-4H3/p+1/b15-9+,16-11+,17-13+ |
| InChIKey | HZLDTMFBTHHXNV-JFQFLZNYSA-O |
| XLogP | 5.63 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|