C27H32O5 — CID 54315328
7'-methoxy-4,4-dimethyl-5-(3-methyl-5-phenylmethoxypent-3-enyl)spiro[1,3-dioxolane-2,2'-chromene] (PubChem CID 54315328) has the molecular formula C27H32O5 and a molecular weight of 436.55 g/mol. Its IUPAC name is 7'-methoxy-4,4-dimethyl-5-(3-methyl-5-phenylmethoxypent-3-enyl)spiro[1,3-dioxolane-2,2'-chromene].
| Compound Name | 7'-methoxy-4,4-dimethyl-5-(3-methyl-5-phenylmethoxypent-3-enyl)spiro[1,3-dioxolane-2,2'-chromene] |
|---|---|
| PubChem CID | 54315328 |
| Molecular Formula | C27H32O5 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 7'-methoxy-4,4-dimethyl-5-(3-methyl-5-phenylmethoxypent-3-enyl)spiro[1,3-dioxolane-2,2'-chromene] |
| SMILES | COc1ccc2c(c1)OC1(C=C2)OC(CCC(C)=CCOCc2ccccc2)C(C)(C)O1 |
| InChI | InChI=1S/C27H32O5/c1-20(15-17-29-19-21-8-6-5-7-9-21)10-13-25-26(2,3)32-27(31-25)16-14-22-11-12-23(28-4)18-24(22)30-27/h5-9,11-12,14-16,18,25H,10,13,17,19H2,1-4H3 |
| InChIKey | SNTIFLDINWKZFV-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|