C40H44O9 — CID 58662800
7-[(E)-5-[5'-[(E)-5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enoxy]-5,5-dimethylspiro[1,3-dioxolane-2,7'-furo[3,2-g]chromene]-4-yl]-3-methylpent-2-enoxy]chromen-2-one (PubChem CID 58662800) has the molecular formula C40H44O9 and a molecular weight of 668.78 g/mol. Its IUPAC name is 7-[(E)-5-[5'-[(E)-5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enoxy]-5,5-dimethylspiro[1,3-dioxolane-2,7'-furo[3,2-g]chromene]-4-yl]-3-methylpent-2-enoxy]chromen-2-one.
| Compound Name | 7-[(E)-5-[5'-[(E)-5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enoxy]-5,5-dimethylspiro[1,3-dioxolane-2,7'-furo[3,2-g]chromene]-4-yl]-3-methylpent-2-enoxy]chromen-2-one |
|---|---|
| PubChem CID | 58662800 |
| Molecular Formula | C40H44O9 |
| Molecular Weight | 668.78 g/mol |
| Exact Mass | 668.30 |
| IUPAC Name | 7-[(E)-5-[5'-[(E)-5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enoxy]-5,5-dimethylspiro[1,3-dioxolane-2,7'-furo[3,2-g]chromene]-4-yl]-3-methylpent-2-enoxy]chromen-2-one |
| SMILES | C/C(=C\COC1=CC2(Oc3cc4occc4cc31)OC(CC/C(C)=C/COc1ccc3ccc(=O)oc3c1)C(C)(C)O2)CCC1OC1(C)C |
| InChI | InChI=1S/C40H44O9/c1-25(15-18-42-29-11-9-27-10-14-37(41)45-32(27)22-29)8-13-36-39(5,6)49-40(48-36)24-34(30-21-28-17-20-43-31(28)23-33(30)46-40)44-19-16-26(2)7-12-35-38(3,4)47-35/h9-11,14-17,20-24,35-36H,7-8,12-13,18-19H2,1-6H3/b25-15+,26-16+ |
| InChIKey | FJUCJFICIQYUHK-RYQLWAFASA-N |
| XLogP | 8.85 |
| TPSA | 102.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.78 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|