C32H32O6 — CID 143436878
(2R)-4,4,7'-trimethyl-5-[(E)-3-methyl-5-(7-methylidenefuro[3,2-g]chromen-4-yl)oxypent-3-enyl]spiro[1,3-dioxolane-2,2'-chromene] (PubChem CID 143436878) has the molecular formula C32H32O6 and a molecular weight of 512.60 g/mol. Its IUPAC name is (2R)-4,4,7'-trimethyl-5-[(E)-3-methyl-5-(7-methylidenefuro[3,2-g]chromen-4-yl)oxypent-3-enyl]spiro[1,3-dioxolane-2,2'-chromene].
| Compound Name | (2R)-4,4,7'-trimethyl-5-[(E)-3-methyl-5-(7-methylidenefuro[3,2-g]chromen-4-yl)oxypent-3-enyl]spiro[1,3-dioxolane-2,2'-chromene] |
|---|---|
| PubChem CID | 143436878 |
| Molecular Formula | C32H32O6 |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | (2R)-4,4,7'-trimethyl-5-[(E)-3-methyl-5-(7-methylidenefuro[3,2-g]chromen-4-yl)oxypent-3-enyl]spiro[1,3-dioxolane-2,2'-chromene] |
| SMILES | C=C1C=Cc2c(cc3occc3c2OC/C=C(\C)CCC2O[C@@]3(C=Cc4ccc(C)cc4O3)OC2(C)C)O1 |
| InChI | InChI=1S/C32H32O6/c1-20(13-16-34-30-24-10-8-22(3)35-28(24)19-27-25(30)14-17-33-27)7-11-29-31(4,5)38-32(37-29)15-12-23-9-6-21(2)18-26(23)36-32/h6,8-10,12-15,17-19,29H,3,7,11,16H2,1-2,4-5H3/b20-13+/t29?,32-/m0/s1 |
| InChIKey | KFIWVTKFPXDLIA-YYAONTOWSA-N |
| XLogP | 7.72 |
| TPSA | 59.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|