C16H24O4 — CID 70549049
1-[(E)-4,4-diethoxy-3-methylbut-2-enoxy]-3-methoxybenzene (PubChem CID 70549049) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is 1-[(E)-4,4-diethoxy-3-methylbut-2-enoxy]-3-methoxybenzene.
| Compound Name | 1-[(E)-4,4-diethoxy-3-methylbut-2-enoxy]-3-methoxybenzene |
|---|---|
| PubChem CID | 70549049 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 1-[(E)-4,4-diethoxy-3-methylbut-2-enoxy]-3-methoxybenzene |
| SMILES | CCOC(OCC)/C(C)=C/COc1cccc(OC)c1 |
| InChI | InChI=1S/C16H24O4/c1-5-18-16(19-6-2)13(3)10-11-20-15-9-7-8-14(12-15)17-4/h7-10,12,16H,5-6,11H2,1-4H3/b13-10+ |
| InChIKey | UXEQYPFCNFGIMO-JLHYYAGUSA-N |
| XLogP | 3.42 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|