C20H30O2 — CID 54350423
6-(7-ethyl-3-methylnon-2-enoxy)-2,3-dihydro-1-benzofuran (PubChem CID 54350423) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is 6-(7-ethyl-3-methylnon-2-enoxy)-2,3-dihydro-1-benzofuran.
| Compound Name | 6-(7-ethyl-3-methylnon-2-enoxy)-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 54350423 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 6-(7-ethyl-3-methylnon-2-enoxy)-2,3-dihydro-1-benzofuran |
| SMILES | CCC(CC)CCCC(C)=CCOc1ccc2c(c1)OCC2 |
| InChI | InChI=1S/C20H30O2/c1-4-17(5-2)8-6-7-16(3)11-13-21-19-10-9-18-12-14-22-20(18)15-19/h9-11,15,17H,4-8,12-14H2,1-3H3 |
| InChIKey | UFIGAIJORTZLJH-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|