C18H24O3 — CID 70122710
5-[5-(2,2-dimethylcyclopropyl)-3-methylpent-2-enoxy]-1,3-benzodioxole (PubChem CID 70122710) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is 5-[5-(2,2-dimethylcyclopropyl)-3-methylpent-2-enoxy]-1,3-benzodioxole.
| Compound Name | 5-[5-(2,2-dimethylcyclopropyl)-3-methylpent-2-enoxy]-1,3-benzodioxole |
|---|---|
| PubChem CID | 70122710 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 5-[5-(2,2-dimethylcyclopropyl)-3-methylpent-2-enoxy]-1,3-benzodioxole |
| SMILES | CC(=CCOc1ccc2c(c1)OCO2)CCC1CC1(C)C |
| InChI | InChI=1S/C18H24O3/c1-13(4-5-14-11-18(14,2)3)8-9-19-15-6-7-16-17(10-15)21-12-20-16/h6-8,10,14H,4-5,9,11-12H2,1-3H3 |
| InChIKey | YIRRZOZKDUXAPS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|