C18H26O4 — CID 154193308
5-(3-methyl-5-pentan-3-yloxypent-2-enoxy)-1,3-benzodioxole (PubChem CID 154193308) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is 5-(3-methyl-5-pentan-3-yloxypent-2-enoxy)-1,3-benzodioxole.
| Compound Name | 5-(3-methyl-5-pentan-3-yloxypent-2-enoxy)-1,3-benzodioxole |
|---|---|
| PubChem CID | 154193308 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 5-(3-methyl-5-pentan-3-yloxypent-2-enoxy)-1,3-benzodioxole |
| SMILES | CCC(CC)OCCC(C)=CCOc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H26O4/c1-4-15(5-2)19-10-8-14(3)9-11-20-16-6-7-17-18(12-16)22-13-21-17/h6-7,9,12,15H,4-5,8,10-11,13H2,1-3H3 |
| InChIKey | NHPSVSMERRBVJX-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|