C13H25NO3 — CID 76627517
2-(2,6-dimethylnon-6-en-2-yloxy)-N-hydroxyacetamide (PubChem CID 76627517) has the molecular formula C13H25NO3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 2-(2,6-dimethylnon-6-en-2-yloxy)-N-hydroxyacetamide.
| Compound Name | 2-(2,6-dimethylnon-6-en-2-yloxy)-N-hydroxyacetamide |
|---|---|
| PubChem CID | 76627517 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | 2-(2,6-dimethylnon-6-en-2-yloxy)-N-hydroxyacetamide |
| SMILES | CCC=C(C)CCCC(C)(C)OCC(=O)NO |
| InChI | InChI=1S/C13H25NO3/c1-5-7-11(2)8-6-9-13(3,4)17-10-12(15)14-16/h7,16H,5-6,8-10H2,1-4H3,(H,14,15) |
| InChIKey | ZNKYVHKQSNEKKG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|