C16H31NO3 — CID 89264524
(E)-N-[2-(2-hydroxyethoxy)ethyl]-8-methylundec-8-enamide (PubChem CID 89264524) has the molecular formula C16H31NO3 and a molecular weight of 285.43 g/mol. Its IUPAC name is (E)-N-[2-(2-hydroxyethoxy)ethyl]-8-methylundec-8-enamide.
| Compound Name | (E)-N-[2-(2-hydroxyethoxy)ethyl]-8-methylundec-8-enamide |
|---|---|
| PubChem CID | 89264524 |
| Molecular Formula | C16H31NO3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.23 |
| IUPAC Name | (E)-N-[2-(2-hydroxyethoxy)ethyl]-8-methylundec-8-enamide |
| SMILES | CC/C=C(\C)CCCCCCC(=O)NCCOCCO |
| InChI | InChI=1S/C16H31NO3/c1-3-8-15(2)9-6-4-5-7-10-16(19)17-11-13-20-14-12-18/h8,18H,3-7,9-14H2,1-2H3,(H,17,19)/b15-8+ |
| InChIKey | CWVMKXOIZVQNQQ-OVCLIPMQSA-N |
| XLogP | 2.81 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|