C16H27Br — CID 54124836
1-bromo-3,7,10,11-tetramethyldodeca-2,6,10-triene (PubChem CID 54124836) has the molecular formula C16H27Br and a molecular weight of 299.30 g/mol. Its IUPAC name is 1-bromo-3,7,10,11-tetramethyldodeca-2,6,10-triene.
| Compound Name | 1-bromo-3,7,10,11-tetramethyldodeca-2,6,10-triene |
|---|---|
| PubChem CID | 54124836 |
| Molecular Formula | C16H27Br |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 1-bromo-3,7,10,11-tetramethyldodeca-2,6,10-triene |
| SMILES | CC(=CCBr)CCC=C(C)CCC(C)=C(C)C |
| InChI | InChI=1S/C16H27Br/c1-13(2)16(5)10-9-14(3)7-6-8-15(4)11-12-17/h7,11H,6,8-10,12H2,1-5H3 |
| InChIKey | NQFDQRKMNAEWTI-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|